Structure of PDB 4m81 Chain A Binding Site BS02 |
|
|
Ligand ID | PNW |
InChI | InChI=1S/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9-,10+,11-,12-/m1/s1 |
InChIKey | IFBHRQDFSNCLOZ-RMPHRYRLSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | [O-][N+](=O)c2ccc(OC1OC(C(O)C(O)C1O)CO)cc2 | OpenEye OEToolkits 1.7.0 | c1cc(ccc1[N+](=O)[O-])O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O | CACTVS 3.370 | OC[C@H]1O[C@@H](Oc2ccc(cc2)[N+]([O-])=O)[C@H](O)[C@@H](O)[C@@H]1O | OpenEye OEToolkits 1.7.0 | c1cc(ccc1[N+](=O)[O-])OC2C(C(C(C(O2)CO)O)O)O | CACTVS 3.370 | OC[CH]1O[CH](Oc2ccc(cc2)[N+]([O-])=O)[CH](O)[CH](O)[CH]1O |
|
Formula | C12 H15 N O8 |
Name | 4-nitrophenyl beta-D-glucopyranoside; 4'-NITROPHENYL-BETA-D-GLUCOPYRANOSIDE; 4-nitrophenyl beta-D-glucoside; 4-nitrophenyl D-glucoside; 4-nitrophenyl glucoside |
ChEMBL | CHEMBL152723 |
DrugBank | |
ZINC | ZINC000004028812
|
PDB chain | 4m81 Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E192 S292 |
Catalytic site (residue number reindexed from 1) |
E186 S286 |
Enzyme Commision number |
2.4.1.- 3.2.1.58: glucan 1,3-beta-glucosidase. |
|
|
|