Structure of PDB 4lal Chain A Binding Site BS02 |
|
|
Ligand ID | 5CU |
InChI | InChI=1S/C5H4N2O4/c8-3-2(4(9)10)1-6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11) |
InChIKey | ZXYAAVBXHKCJJB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1C(C(=O)O)=CNC(=O)N1 | OpenEye OEToolkits 1.7.6 | C1=C(C(=O)NC(=O)N1)C(=O)O | CACTVS 3.385 | OC(=O)C1=CNC(=O)NC1=O |
|
Formula | C5 H4 N2 O4 |
Name | 2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid |
ChEMBL | CHEMBL1213478 |
DrugBank | |
ZINC | ZINC000000901606
|
PDB chain | 4lal Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|