Structure of PDB 4kuy Chain A Binding Site BS02 |
|
|
Ligand ID | MB4 |
InChI | InChI=1S/C13H14N4O5S2/c1-9-4-2-3-5-11(9)24(21,22)17-13(18)16-10-6-7-12(15-8-10)23(14,19)20/h2-8H,1H3,(H2,14,19,20)(H2,16,17,18) |
InChIKey | FSPCZTCUVKLQSU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Cc1ccccc1[S](=O)(=O)NC(=O)Nc2ccc(nc2)[S](N)(=O)=O | ACDLabs 12.01 | O=S(=O)(c2ncc(NC(=O)NS(=O)(=O)c1ccccc1C)cc2)N | OpenEye OEToolkits 1.7.6 | Cc1ccccc1S(=O)(=O)NC(=O)Nc2ccc(nc2)S(=O)(=O)N |
|
Formula | C13 H14 N4 O5 S2 |
Name | 5-({[(2-methylphenyl)sulfonyl]carbamoyl}amino)pyridine-2-sulfonamide |
ChEMBL | CHEMBL3354127 |
DrugBank | |
ZINC | ZINC000098209166
|
PDB chain | 4kuy Chain A Residue 304
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|