Structure of PDB 4ks2 Chain A Binding Site BS02 |
|
|
Ligand ID | 1SJ |
InChI | InChI=1S/C15H26N4O4/c1-4-10(5-2)23-12-7-9(14(21)22)6-11(19-15(16)17)13(12)18-8(3)20/h6,10-13H,4-5,7H2,1-3H3,(H,18,20)(H,21,22)(H4,16,17,19)/t11-,12+,13+/m0/s1 |
InChIKey | HGYRNBWLYZJBDT-YNEHKIRRSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | [H]/N=C(\N)/N[C@H]1C=C(C[C@H]([C@@H]1NC(=O)C)OC(CC)CC)C(=O)O | CACTVS 3.370 | CCC(CC)O[C@@H]1CC(=C[C@H](NC(N)=N)[C@H]1NC(C)=O)C(O)=O | OpenEye OEToolkits 1.7.6 | CCC(CC)OC1CC(=CC(C1NC(=O)C)NC(=N)N)C(=O)O | CACTVS 3.370 | CCC(CC)O[CH]1CC(=C[CH](NC(N)=N)[CH]1NC(C)=O)C(O)=O | ACDLabs 12.01 | O=C(O)C1=CC(NC(=[N@H])N)C(NC(=O)C)C(OC(CC)CC)C1 |
|
Formula | C15 H26 N4 O4 |
Name | (3S,4R,5R)-4-(acetylamino)-3-carbamimidamido-5-(pentan-3-yloxy)cyclohex-1-ene-1-carboxylic acid |
ChEMBL | CHEMBL1618066 |
DrugBank | |
ZINC | ZINC000064526875
|
PDB chain | 4ks2 Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|