Structure of PDB 4k9t Chain A Binding Site BS02 |
|
|
Ligand ID | 1RD |
InChI | InChI=1S/C23H36N6O4S2/c1-15(2)19(28-22(31)29(5)11-17-13-34-21(27-17)16(3)4)20(30)25-8-6-7-9-26-23(32)33-12-18-10-24-14-35-18/h10,13-16,19H,6-9,11-12H2,1-5H3,(H,25,30)(H,26,32)(H,28,31)/t19-/m0/s1 |
InChIKey | OWSUPSVMUSHQHC-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(C)c1nc(cs1)CN(C)C(=O)N[C@@H](C(C)C)C(=O)NCCCCNC(=O)OCc2cncs2 | OpenEye OEToolkits 1.7.6 | CC(C)c1nc(cs1)CN(C)C(=O)NC(C(C)C)C(=O)NCCCCNC(=O)OCc2cncs2 | CACTVS 3.370 | CC(C)[CH](NC(=O)N(C)Cc1csc(n1)C(C)C)C(=O)NCCCCNC(=O)OCc2scnc2 | ACDLabs 12.01 | O=C(OCc1scnc1)NCCCCNC(=O)C(NC(=O)N(Cc2nc(sc2)C(C)C)C)C(C)C | CACTVS 3.370 | CC(C)[C@H](NC(=O)N(C)Cc1csc(n1)C(C)C)C(=O)NCCCCNC(=O)OCc2scnc2 |
|
Formula | C23 H36 N6 O4 S2 |
Name | N~2~-(methyl{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}carbamoyl)-N-(4-{[(1,3-thiazol-5-ylmethoxy)carbonyl]amino}butyl)-L-valinamide |
ChEMBL | CHEMBL3114723 |
DrugBank | |
ZINC | ZINC000098208015
|
PDB chain | 4k9t Chain A Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
Molecular Function |
GO:0004497 |
monooxygenase activity |
GO:0005496 |
steroid binding |
GO:0005506 |
iron ion binding |
GO:0005515 |
protein binding |
GO:0008395 |
steroid hydroxylase activity |
GO:0008401 |
retinoic acid 4-hydroxylase activity |
GO:0016491 |
oxidoreductase activity |
GO:0016705 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen |
GO:0016712 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen |
GO:0019825 |
oxygen binding |
GO:0019899 |
enzyme binding |
GO:0020037 |
heme binding |
GO:0030343 |
vitamin D3 25-hydroxylase activity |
GO:0034875 |
caffeine oxidase activity |
GO:0046872 |
metal ion binding |
GO:0050591 |
quinine 3-monooxygenase activity |
GO:0050649 |
testosterone 6-beta-hydroxylase activity |
GO:0062181 |
1-alpha,25-dihydroxyvitamin D3 23-hydroxylase activity |
GO:0062187 |
anandamide 8,9 epoxidase activity |
GO:0062188 |
anandamide 11,12 epoxidase activity |
GO:0062189 |
anandamide 14,15 epoxidase activity |
GO:0070330 |
aromatase activity |
GO:0070576 |
vitamin D 24-hydroxylase activity |
GO:0101020 |
estrogen 16-alpha-hydroxylase activity |
GO:0101021 |
estrogen 2-hydroxylase activity |
GO:0102320 |
1,8-cineole 2-exo-monooxygenase activity |
|
|