Structure of PDB 4is0 Chain A Binding Site BS02 |
|
|
Ligand ID | 1R4 |
InChI | InChI=1S/C18H22N4O9S/c19-12(18(28)29)5-6-15(24)21-13(17(27)20-7-16(25)26)8-32-9-14(23)10-1-3-11(4-2-10)22(30)31/h1-4,12-13H,5-9,19H2,(H,20,27)(H,21,24)(H,25,26)(H,28,29)/t12-,13-/m0/s1 |
InChIKey | DFOFAMKKGYFIOO-STQMWFEESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(ccc1C(=O)CSCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N)[N+](=O)[O-] | CACTVS 3.370 | N[C@@H](CCC(=O)N[C@@H](CSCC(=O)c1ccc(cc1)[N+]([O-])=O)C(=O)NCC(O)=O)C(O)=O | OpenEye OEToolkits 1.7.6 | c1cc(ccc1C(=O)CSC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(=O)O)N)[N+](=O)[O-] | CACTVS 3.370 | N[CH](CCC(=O)N[CH](CSCC(=O)c1ccc(cc1)[N+]([O-])=O)C(=O)NCC(O)=O)C(O)=O | ACDLabs 12.01 | O=[N+]([O-])c1ccc(C(=O)CSCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N)cc1 |
|
Formula | C18 H22 N4 O9 S |
Name | L-gamma-glutamyl-S-[2-(4-nitrophenyl)-2-oxoethyl]-L-cysteinylglycine; S-(4-nitrophenacyl)glutathione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920733
|
PDB chain | 4is0 Chain A Residue 905
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.20.4.2: methylarsonate reductase. 1.8.5.1: glutathione dehydrogenase (ascorbate). 2.5.1.18: glutathione transferase. |
|
|
Biological Process |
GO:0006749 |
glutathione metabolic process |
GO:0010880 |
regulation of release of sequestered calcium ion into cytosol by sarcoplasmic reticulum |
GO:0010881 |
regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion |
GO:0014810 |
positive regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion |
GO:0019852 |
L-ascorbic acid metabolic process |
GO:0042178 |
xenobiotic catabolic process |
GO:0060315 |
negative regulation of ryanodine-sensitive calcium-release channel activity |
GO:0060316 |
positive regulation of ryanodine-sensitive calcium-release channel activity |
GO:0071243 |
cellular response to arsenic-containing substance |
GO:0098869 |
cellular oxidant detoxification |
|
|