Structure of PDB 4iqw Chain A Binding Site BS02 |
|
|
Ligand ID | 1FQ |
InChI | InChI=1S/C17H12FNO5/c18-12-3-1-10(2-4-12)16(22)11-7-13(19-9-11)5-6-14(20)8-15(21)17(23)24/h1-9,19,21H,(H,23,24)/b6-5+,15-8- |
InChIKey | XOINLIFLBUUBGT-RSIRFQHMSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC(=O)C(/O)=C/C(=O)\C=C\c1[nH]cc(c1)C(=O)c2ccc(F)cc2 | CACTVS 3.370 | OC(=O)C(O)=CC(=O)C=Cc1[nH]cc(c1)C(=O)c2ccc(F)cc2 | ACDLabs 12.01 | O=C(c1cc(/C=C/C(=O)\C=C(/O)C(=O)O)nc1)c2ccc(F)cc2 | OpenEye OEToolkits 1.7.6 | c1cc(ccc1C(=O)c2cc([nH]c2)/C=C/C(=O)/C=C(/C(=O)O)\O)F | OpenEye OEToolkits 1.7.6 | c1cc(ccc1C(=O)c2cc([nH]c2)C=CC(=O)C=C(C(=O)O)O)F |
|
Formula | C17 H12 F N O5 |
Name | (2Z,5E)-6-[4-(4-fluorobenzoyl)-1H-pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000103521905
|
PDB chain | 4iqw Chain A Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|