Structure of PDB 4iq9 Chain A Binding Site BS02 |
|
|
Ligand ID | 1GB |
InChI | InChI=1S/C20H19N3O3/c24-14-7-5-12(6-8-14)9-17-19(25)23-18(20(26)22-17)10-13-11-21-16-4-2-1-3-15(13)16/h1-8,11,17-18,21,24H,9-10H2,(H,22,26)(H,23,25)/t17-,18-/m0/s1 |
InChIKey | ZJDMXAAEAVGGSK-ROUUACIJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)c(c[nH]2)CC3C(=O)NC(C(=O)N3)Cc4ccc(cc4)O | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)c(c[nH]2)C[C@H]3C(=O)N[C@H](C(=O)N3)Cc4ccc(cc4)O | CACTVS 3.370 | Oc1ccc(C[C@@H]2NC(=O)[C@H](Cc3c[nH]c4ccccc34)NC2=O)cc1 | ACDLabs 12.01 | O=C1NC(C(=O)NC1Cc2ccc(O)cc2)Cc3cnc4ccccc34 | CACTVS 3.370 | Oc1ccc(C[CH]2NC(=O)[CH](Cc3c[nH]c4ccccc34)NC2=O)cc1 |
|
Formula | C20 H19 N3 O3 |
Name | (3S,6S)-3-(4-hydroxybenzyl)-6-(1H-indol-3-ylmethyl)piperazine-2,5-dione |
ChEMBL | CHEMBL191476 |
DrugBank | |
ZINC | ZINC000004899565
|
PDB chain | 4iq9 Chain A Residue 410
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|