Structure of PDB 4iq7 Chain A Binding Site BS02 |
|
|
Ligand ID | 1G9 |
InChI | InChI=1S/C12H14N2O3/c1-7-11(16)14-10(12(17)13-7)6-8-2-4-9(15)5-3-8/h2-5,7,10,15H,6H2,1H3,(H,13,17)(H,14,16)/t7-,10-/m0/s1 |
InChIKey | MFUNIDMQFPXVGU-XVKPBYJWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC1C(=O)NC(C(=O)N1)Cc2ccc(cc2)O | OpenEye OEToolkits 1.7.6 | C[C@H]1C(=O)N[C@H](C(=O)N1)Cc2ccc(cc2)O | CACTVS 3.370 | C[C@@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC1=O | CACTVS 3.370 | C[CH]1NC(=O)[CH](Cc2ccc(O)cc2)NC1=O | ACDLabs 12.01 | O=C1NC(C(=O)NC1C)Cc2ccc(O)cc2 |
|
Formula | C12 H14 N2 O3 |
Name | (3S,6S)-3-(4-hydroxybenzyl)-6-methylpiperazine-2,5-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000014444078
|
PDB chain | 4iq7 Chain A Residue 406
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|