Structure of PDB 4ips Chain A Binding Site BS02 |
|
|
Ligand ID | 1G4 |
InChI | InChI=1S/C18H20N2O3/c21-15-5-1-12(2-6-15)9-14-11-19-17(18(23)20-14)10-13-3-7-16(22)8-4-13/h1-8,14,17,19,21-22H,9-11H2,(H,20,23)/t14-,17-/m0/s1 |
InChIKey | WZUSPDRVLVOBKD-YOEHRIQHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(ccc1CC2CNC(C(=O)N2)Cc3ccc(cc3)O)O | ACDLabs 12.01 | O=C2NC(Cc1ccc(O)cc1)CNC2Cc3ccc(O)cc3 | CACTVS 3.370 | Oc1ccc(C[C@H]2CN[C@@H](Cc3ccc(O)cc3)C(=O)N2)cc1 | OpenEye OEToolkits 1.7.6 | c1cc(ccc1C[C@H]2CN[C@H](C(=O)N2)Cc3ccc(cc3)O)O | CACTVS 3.370 | Oc1ccc(C[CH]2CN[CH](Cc3ccc(O)cc3)C(=O)N2)cc1 |
|
Formula | C18 H20 N2 O3 |
Name | (3S,6S)-3,6-bis(4-hydroxybenzyl)piperazin-2-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920741
|
PDB chain | 4ips Chain A Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|