Structure of PDB 4ims Chain A Binding Site BS02 |
|
|
Ligand ID | 12S |
InChI | InChI=1S/C25H33N5/c1-17-10-22(29-24(27)12-17)7-5-20-14-19(4-3-9-26)15-21(16-20)6-8-23-11-18(2)13-25(28)30-23/h10-16H,3-9,26H2,1-2H3,(H2,27,29)(H2,28,30) |
InChIKey | TUMIYXWSFLIVFR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Cc1cc(N)nc(CCc2cc(CCCN)cc(CCc3cc(C)cc(N)n3)c2)c1 | OpenEye OEToolkits 1.7.6 | Cc1cc(nc(c1)N)CCc2cc(cc(c2)CCc3cc(cc(n3)N)C)CCCN | ACDLabs 12.01 | n1c(N)cc(cc1CCc2cc(cc(c2)CCCN)CCc3nc(N)cc(c3)C)C |
|
Formula | C25 H33 N5 |
Name | 6,6'-{[5-(3-aminopropyl)benzene-1,3-diyl]diethane-2,1-diyl}bis(4-methylpyridin-2-amine) |
ChEMBL | CHEMBL2326358 |
DrugBank | |
ZINC | ZINC000095581143
|
PDB chain | 4ims Chain A Residue 802
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|