Structure of PDB 4ict Chain A Binding Site BS02 |
|
|
Ligand ID | 1ED |
InChI | InChI=1S/C18H18N2O3/c21-14-8-6-13(7-9-14)11-16-18(23)19-15(17(22)20-16)10-12-4-2-1-3-5-12/h1-9,15-16,21H,10-11H2,(H,19,23)(H,20,22)/t15-,16-/m0/s1 |
InChIKey | GRWVBLRIPRGGPD-HOTGVXAUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc(cc1)CC2C(=O)NC(C(=O)N2)Cc3ccc(cc3)O | ACDLabs 12.01 | O=C1NC(C(=O)NC1Cc2ccccc2)Cc3ccc(O)cc3 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)C[C@H]2C(=O)N[C@H](C(=O)N2)Cc3ccc(cc3)O | CACTVS 3.370 | Oc1ccc(C[CH]2NC(=O)[CH](Cc3ccccc3)NC2=O)cc1 | CACTVS 3.370 | Oc1ccc(C[C@@H]2NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 |
|
Formula | C18 H18 N2 O3 |
Name | (3S,6S)-3-benzyl-6-(4-hydroxybenzyl)piperazine-2,5-dione |
ChEMBL | CHEMBL191426 |
DrugBank | |
ZINC | ZINC000013376427
|
PDB chain | 4ict Chain A Residue 406
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|