Structure of PDB 4hyu Chain A Binding Site BS02 |
|
|
Ligand ID | 1BK |
InChI | InChI=1S/C21H27N5O4S/c1-31(28,29)13-3-12-30-19-5-2-4-18-17(19)14-23-26(18)20-10-11-22-21(25-20)24-15-6-8-16(27)9-7-15/h2,4-5,10-11,14-16,27H,3,6-9,12-13H2,1H3,(H,22,24,25)/t15-,16- |
InChIKey | QTUUSRHXDAHSAU-WKILWMFISA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S(=O)(C)CCCOc1cccc2c1cnn2c3nc(ncc3)NC4CCC(O)CC4 | OpenEye OEToolkits 1.7.6 | CS(=O)(=O)CCCOc1cccc2c1cnn2c3ccnc(n3)NC4CCC(CC4)O | CACTVS 3.370 | C[S](=O)(=O)CCCOc1cccc2n(ncc12)c3ccnc(N[CH]4CC[CH](O)CC4)n3 | CACTVS 3.370 | C[S](=O)(=O)CCCOc1cccc2n(ncc12)c3ccnc(N[C@@H]4CC[C@@H](O)CC4)n3 |
|
Formula | C21 H27 N5 O4 S |
Name | trans-4-[(4-{4-[3-(methylsulfonyl)propoxy]-1H-indazol-1-yl}pyrimidin-2-yl)amino]cyclohexanol |
ChEMBL | CHEMBL2390974 |
DrugBank | |
ZINC |
|
PDB chain | 4hyu Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|