Structure of PDB 4hev Chain A Binding Site BS02 |
|
|
Ligand ID | AXM |
InChI | InChI=1S/C12H19NO2/c14-11(13-15)7-12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10,15H,1-7H2,(H,13,14)/t8-,9+,10-,12- |
InChIKey | JKZCKUGJZBWOQO-GOCCLTDMSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(NO)CC13CC2CC(CC(C1)C2)C3 | CACTVS 3.370 | ONC(=O)CC12CC3CC(CC(C3)C1)C2 | OpenEye OEToolkits 1.7.6 | C1C2CC3CC1CC(C2)(C3)CC(=O)NO |
|
Formula | C12 H19 N O2 |
Name | N-hydroxy-2-[(3S,5S,7S)-tricyclo[3.3.1.1~3,7~]dec-1-yl]acetamide; Adamantane acetic acid hydroxamate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4hev Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|