Structure of PDB 4h4e Chain A Binding Site BS02 |
|
|
Ligand ID | 10G |
InChI | InChI=1S/C5H12O7P2S/c1-5(4-15)2-3-11-14(9,10)12-13(6,7)8/h2,15H,3-4H2,1H3,(H,9,10)(H2,6,7,8)/b5-2+ |
InChIKey | YSUKJHNOIKPIFM-GORDUTHDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(=CCOP(=O)(O)OP(=O)(O)O)CS | CACTVS 3.370 | C\C(CS)=C/CO[P](O)(=O)O[P](O)(O)=O | CACTVS 3.370 | CC(CS)=CCO[P](O)(=O)O[P](O)(O)=O | ACDLabs 12.01 | O=P(OP(=O)(OC/C=C(\C)CS)O)(O)O | OpenEye OEToolkits 1.7.6 | C/C(=C\COP(=O)(O)OP(=O)(O)O)/CS |
|
Formula | C5 H12 O7 P2 S |
Name | (2E)-3-methyl-4-sulfanylbut-2-en-1-yl trihydrogen diphosphate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098207909
|
PDB chain | 4h4e Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.17.7.4: 4-hydroxy-3-methylbut-2-enyl diphosphate reductase. |
|
|
|