Structure of PDB 4gl7 Chain A Binding Site BS02 |
|
|
Ligand ID | 0XJ |
InChI | InChI=1S/C24H30O3/c1-4-5-6-13-27-21-15-17-18-7-8-22(26)24(18,3)12-10-19(17)23(2)11-9-16(25)14-20(21)23/h9,11,14,17-19,21H,4,7-8,10,12-13,15H2,1-3H3/t17-,18-,19-,21+,23+,24-/m0/s1 |
InChIKey | VZGAHAQWKVTWEF-RAPVPNNWSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C4C3(CCC2C1(C=CC(=O)C=C1C(OCC#CCC)CC2C3CC4)C)C | CACTVS 3.370 | CCC#CCO[C@@H]1C[C@H]2[C@@H]3CCC(=O)[C@@]3(C)CC[C@@H]2[C@@]4(C)C=CC(=O)C=C14 | OpenEye OEToolkits 1.7.6 | CCC#CCOC1CC2C3CCC(=O)C3(CCC2C4(C1=CC(=O)C=C4)C)C | OpenEye OEToolkits 1.7.6 | CCC#CCO[C@@H]1C[C@H]2[C@@H]3CCC(=O)[C@]3(CC[C@@H]2[C@@]4(C1=CC(=O)C=C4)C)C | CACTVS 3.370 | CCC#CCO[CH]1C[CH]2[CH]3CCC(=O)[C]3(C)CC[CH]2[C]4(C)C=CC(=O)C=C14 |
|
Formula | C24 H30 O3 |
Name | (6alpha,8alpha)-6-(pent-2-yn-1-yloxy)androsta-1,4-diene-3,17-dione |
ChEMBL | CHEMBL2179110 |
DrugBank | |
ZINC | ZINC000072317681
|
PDB chain | 4gl7 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|