Structure of PDB 4ghr Chain A Binding Site BS02 |
|
|
Ligand ID | ITE |
InChI | InChI=1S/C10H9N5O/c1-11-10-14-7-2-5-6(3-8(7)15-10)12-4-13-9(5)16/h2-4H,1H3,(H2,11,14,15)(H,12,13,16) |
InChIKey | DGRUEIDKEKQZFU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | CNc1[nH]c2cc3c(cc2n1)N=CNC3=O | CACTVS 3.370 | CNc1[nH]c2cc3C(=O)NC=Nc3cc2n1 | ACDLabs 12.01 | O=C2c3cc1nc(nc1cc3N=CN2)NC |
|
Formula | C10 H9 N5 O |
Name | 2-(methylamino)-1,7-dihydro-8H-imidazo[4,5-g]quinazolin-8-one |
ChEMBL | CHEMBL3298016 |
DrugBank | |
ZINC | ZINC000095921288
|
PDB chain | 4ghr Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|