Structure of PDB 4gae Chain A Binding Site BS02 |
|
|
Ligand ID | FOB |
InChI | InChI=1S/C10H15N2O5P/c1-8(13)12(14)7-4-10(18(15,16)17)9-2-5-11-6-3-9/h2-3,5-6,10,14H,4,7H2,1H3,(H2,15,16,17)/t10-/m1/s1 |
InChIKey | AMWIPWYKSYZXGB-SNVBAGLBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(=O)N(CCC(c1ccncc1)P(=O)(O)O)O | CACTVS 3.370 | CC(=O)N(O)CC[C@H](c1ccncc1)[P](O)(O)=O | CACTVS 3.370 | CC(=O)N(O)CC[CH](c1ccncc1)[P](O)(O)=O | OpenEye OEToolkits 1.7.6 | CC(=O)N(CC[C@H](c1ccncc1)P(=O)(O)O)O | ACDLabs 12.01 | O=C(N(O)CCC(c1ccncc1)P(=O)(O)O)C |
|
Formula | C10 H15 N2 O5 P |
Name | [(1R)-3-[acetyl(hydroxy)amino]-1-(pyridin-4-yl)propyl]phosphonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095584106
|
PDB chain | 4gae Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.267: 1-deoxy-D-xylulose-5-phosphate reductoisomerase. |
|
|
|