Structure of PDB 4g2j Chain A Binding Site BS02 |
|
|
Ligand ID | 0WF |
InChI | InChI=1S/C21H25N5O2/c1-14(25-12-17(13-25)28-16-9-3-2-4-10-16)19-23-20-18(21(27)24-19)11-22-26(20)15-7-5-6-8-15/h2-4,9-11,14-15,17H,5-8,12-13H2,1H3,(H,23,24,27)/t14-/m1/s1 |
InChIKey | KKFKLLKJGDFZBA-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C[C@H](C1=Nc2c(cnn2C3CCCC3)C(=O)N1)N4CC(C4)Oc5ccccc5 | CACTVS 3.370 | C[CH](N1C[CH](C1)Oc2ccccc2)C3=Nc4n(ncc4C(=O)N3)C5CCCC5 | OpenEye OEToolkits 1.7.6 | CC(C1=Nc2c(cnn2C3CCCC3)C(=O)N1)N4CC(C4)Oc5ccccc5 | ACDLabs 12.01 | O=C1NC(=Nc2c1cnn2C3CCCC3)C(N5CC(Oc4ccccc4)C5)C | CACTVS 3.370 | C[C@@H](N1C[C@H](C1)Oc2ccccc2)C3=Nc4n(ncc4C(=O)N3)C5CCCC5 |
|
Formula | C21 H25 N5 O2 |
Name | 1-cyclopentyl-6-[(1R)-1-(3-phenoxyazetidin-1-yl)ethyl]-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one |
ChEMBL | CHEMBL2180072 |
DrugBank | |
ZINC | ZINC000072315711
|
PDB chain | 4g2j Chain A Residue 903
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.35: 3',5'-cyclic-GMP phosphodiesterase. |
|
|
|