Structure of PDB 4fw7 Chain A Binding Site BS02 |
|
|
Ligand ID | L63 |
InChI | InChI=1S/C17H18N2O4/c1-11(20)15(17(22)19-23)18-16(21)14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-11,15,20,23H,1H3,(H,18,21)(H,19,22)/t11-,15+/m1/s1 |
InChIKey | AXQUTBMFDJGETC-ABAIWWIYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | C[CH](O)[CH](NC(=O)c1ccc(cc1)c2ccccc2)C(=O)NO | OpenEye OEToolkits 1.7.6 | CC(C(C(=O)NO)NC(=O)c1ccc(cc1)c2ccccc2)O | CACTVS 3.370 | C[C@@H](O)[C@H](NC(=O)c1ccc(cc1)c2ccccc2)C(=O)NO | OpenEye OEToolkits 1.7.6 | C[C@H]([C@@H](C(=O)NO)NC(=O)c1ccc(cc1)c2ccccc2)O | ACDLabs 12.01 | O=C(NC(C(=O)NO)C(O)C)c2ccc(c1ccccc1)cc2 |
|
Formula | C17 H18 N2 O4 |
Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]biphenyl-4-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000071788677
|
PDB chain | 4fw7 Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.1.108: UDP-3-O-acyl-N-acetylglucosamine deacetylase. |
|
|
|