Structure of PDB 4fw5 Chain A Binding Site BS02 |
|
|
Ligand ID | L58 |
InChI | InChI=1S/C17H17BrN2O4/c1-10(21)15(17(23)20-24)19-16(22)13-4-2-11(3-5-13)12-6-8-14(18)9-7-12/h2-10,15,21,24H,1H3,(H,19,22)(H,20,23)/t10-,15+/m1/s1 |
InChIKey | OEJYZUMESQZYFQ-BMIGLBTASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C[C@H]([C@@H](C(=O)NO)NC(=O)c1ccc(cc1)c2ccc(cc2)Br)O | CACTVS 3.370 | C[C@@H](O)[C@H](NC(=O)c1ccc(cc1)c2ccc(Br)cc2)C(=O)NO | ACDLabs 12.01 | Brc2ccc(c1ccc(C(=O)NC(C(=O)NO)C(O)C)cc1)cc2 | CACTVS 3.370 | C[CH](O)[CH](NC(=O)c1ccc(cc1)c2ccc(Br)cc2)C(=O)NO | OpenEye OEToolkits 1.7.6 | CC(C(C(=O)NO)NC(=O)c1ccc(cc1)c2ccc(cc2)Br)O |
|
Formula | C17 H17 Br N2 O4 |
Name | 4'-bromo-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]biphenyl-4-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000003818667
|
PDB chain | 4fw5 Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.1.108: UDP-3-O-acyl-N-acetylglucosamine deacetylase. |
|
|
|