Structure of PDB 4fw4 Chain A Binding Site BS02 |
|
|
Ligand ID | 3P3 |
InChI | InChI=1S/C21H18N2O4/c1-15(24)19(21(26)23-27)22-20(25)18-13-11-17(12-14-18)10-6-5-9-16-7-3-2-4-8-16/h2-4,7-8,11-15,19,24,27H,1H3,(H,22,25)(H,23,26)/t15-,19+/m1/s1 |
InChIKey | VUYMSCCEGRLBAF-BEFAXECRSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | C[C@H]([C@@H](C(=O)NO)NC(=O)c1ccc(cc1)C#CC#Cc2ccccc2)O | CACTVS 3.370 | C[C@@H](O)[C@H](NC(=O)c1ccc(cc1)C#CC#Cc2ccccc2)C(=O)NO | ACDLabs 12.01 | O=C(NC(C(=O)NO)C(O)C)c2ccc(C#CC#Cc1ccccc1)cc2 | OpenEye OEToolkits 1.7.0 | CC(C(C(=O)NO)NC(=O)c1ccc(cc1)C#CC#Cc2ccccc2)O | CACTVS 3.370 | C[CH](O)[CH](NC(=O)c1ccc(cc1)C#CC#Cc2ccccc2)C(=O)NO |
|
Formula | C21 H18 N2 O4 |
Name | N-[(1S,2R)-2-hydroxy-1-(hydroxycarbamoyl)propyl]-4-(4-phenylbuta-1,3-diyn-1-yl)benzamide |
ChEMBL | CHEMBL1230182 |
DrugBank | |
ZINC | ZINC000003818661
|
PDB chain | 4fw4 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.1.108: UDP-3-O-acyl-N-acetylglucosamine deacetylase. |
|
|
|