Structure of PDB 4fw3 Chain A Binding Site BS02 |
|
|
Ligand ID | L52 |
InChI | InChI=1S/C20H17N3O3/c21-14-18(20(25)23-26)22-19(24)17-12-10-16(11-13-17)9-5-4-8-15-6-2-1-3-7-15/h1-3,6-7,10-13,18,26H,14,21H2,(H,22,24)(H,23,25)/t18-/m0/s1 |
InChIKey | RMTUQHBOIGEBSC-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | NC[C@H](NC(=O)c1ccc(cc1)C#CC#Cc2ccccc2)C(=O)NO | ACDLabs 12.01 | O=C(NC(C(=O)NO)CN)c2ccc(C#CC#Cc1ccccc1)cc2 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)C#CC#Cc2ccc(cc2)C(=O)N[C@@H](CN)C(=O)NO | CACTVS 3.370 | NC[CH](NC(=O)c1ccc(cc1)C#CC#Cc2ccccc2)C(=O)NO | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)C#CC#Cc2ccc(cc2)C(=O)NC(CN)C(=O)NO |
|
Formula | C20 H17 N3 O3 |
Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-(4-phenylbuta-1,3-diyn-1-yl)benzamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000003818660
|
PDB chain | 4fw3 Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.1.108: UDP-3-O-acyl-N-acetylglucosamine deacetylase. |
|
|
|