Structure of PDB 4fpt Chain A Binding Site BS02 |
|
|
Ligand ID | 0VZ |
InChI | InChI=1S/C6H11N3O4S2/c1-2-13-5(10)4-3-14-6(8-4)9-15(7,11)12/h4H,2-3H2,1H3,(H,8,9)(H2,7,11,12)/t4-/m0/s1 |
InChIKey | JQTAIDJUEICDHW-BYPYZUCNSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCOC(=O)[CH]1CSC(N1)=N[S](N)(=O)=O | CACTVS 3.370 | CCOC(=O)[C@@H]1CSC(N1)=N[S](N)(=O)=O | OpenEye OEToolkits 1.7.6 | CCOC(=O)C1CSC(=NS(=O)(=O)N)N1 | OpenEye OEToolkits 1.7.6 | CCOC(=O)[C@@H]1CS/C(=N\S(=O)(=O)N)/N1 | ACDLabs 12.01 | O=S(=O)(/N=C1\SCC(C(=O)OCC)N1)N |
|
Formula | C6 H11 N3 O4 S2 |
Name | ethyl (2Z,4R)-2-(sulfamoylimino)-1,3-thiazolidine-4-carboxylate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921251
|
PDB chain | 4fpt Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|