Structure of PDB 4fhh Chain A Binding Site BS02 |
|
|
Ligand ID | 0U3 |
InChI | InChI=1S/C27H39NO5/c1-8-27(9-2,21-11-13-23(19(4)15-21)33-17-25(30)28-31)20-10-12-22(18(3)14-20)32-16-24(29)26(5,6)7/h10-15,24,29,31H,8-9,16-17H2,1-7H3,(H,28,30)/t24-/m1/s1 |
InChIKey | HLEDBIQBAUIWNJ-XMMPIXPASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCC(CC)(c1ccc(OC[CH](O)C(C)(C)C)c(C)c1)c2ccc(OCC(=O)NO)c(C)c2 | OpenEye OEToolkits 1.7.6 | CCC(CC)(c1ccc(c(c1)C)OCC(C(C)(C)C)O)c2ccc(c(c2)C)OCC(=O)NO | OpenEye OEToolkits 1.7.6 | CCC(CC)(c1ccc(c(c1)C)OC[C@H](C(C)(C)C)O)c2ccc(c(c2)C)OCC(=O)NO | CACTVS 3.370 | CCC(CC)(c1ccc(OC[C@@H](O)C(C)(C)C)c(C)c1)c2ccc(OCC(=O)NO)c(C)c2 | ACDLabs 12.01 | O=C(NO)COc1ccc(cc1C)C(c2ccc(OCC(O)C(C)(C)C)c(c2)C)(CC)CC |
|
Formula | C27 H39 N O5 |
Name | N-hydroxy-2-{4-[3-(4-{[(2S)-2-hydroxy-3,3-dimethylbutyl]oxy}-3-methylphenyl)pentan-3-yl]-2-methylphenoxy}acetamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921185
|
PDB chain | 4fhh Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|