Structure of PDB 4fat Chain A Binding Site BS02 |
|
|
Ligand ID | 496 |
InChI | InChI=1S/C16H17F3N4O3S/c17-16(18,19)13-8(7-24)5-23(22-13)6-11(25)21-15-12(14(20)26)9-3-1-2-4-10(9)27-15/h5,24H,1-4,6-7H2,(H2,20,26)(H,21,25) |
InChIKey | ZGRBZBGNPZBNLW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | FC(F)(F)c1nn(cc1CO)CC(=O)Nc2sc3c(c2C(=O)N)CCCC3 | OpenEye OEToolkits 1.7.6 | c1c(c(nn1CC(=O)Nc2c(c3c(s2)CCCC3)C(=O)N)C(F)(F)F)CO | CACTVS 3.370 | NC(=O)c1c(NC(=O)Cn2cc(CO)c(n2)C(F)(F)F)sc3CCCCc13 |
|
Formula | C16 H17 F3 N4 O3 S |
Name | 2-({[4-(hydroxymethyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetyl}amino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
ChEMBL | CHEMBL1642150 |
DrugBank | |
ZINC | ZINC000066258674
|
PDB chain | 4fat Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|