Structure of PDB 4efe Chain A Binding Site BS02 |
|
|
Ligand ID | 0OV |
InChI | InChI=1S/C16H19N5O2/c1-10-4-2-3-5-12(10)23-16-19-14(18)13-11(22)6-8-21(9-7-17)15(13)20-16/h6,8,10,12H,2-5,9H2,1H3,(H2,18,19,20)/t10-,12+/m1/s1 |
InChIKey | MZUFVSMPTFUMGZ-PWSUYJOCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | C[C@@H]1CCCC[C@@H]1Oc2nc(N)c3C(=O)C=CN(CC#N)c3n2 | OpenEye OEToolkits 1.7.6 | C[C@@H]1CCCC[C@@H]1Oc2nc(c3c(n2)N(C=CC3=O)CC#N)N | ACDLabs 12.01 | O=C3c1c(nc(nc1N)OC2CCCCC2C)N(C=C3)CC#N | OpenEye OEToolkits 1.7.6 | CC1CCCCC1Oc2nc(c3c(n2)N(C=CC3=O)CC#N)N | CACTVS 3.370 | C[CH]1CCCC[CH]1Oc2nc(N)c3C(=O)C=CN(CC#N)c3n2 |
|
Formula | C16 H19 N5 O2 |
Name | [4-amino-2-{[(1S,2R)-2-methylcyclohexyl]oxy}-5-oxopyrido[2,3-d]pyrimidin-8(5H)-yl]acetonitrile |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920548
|
PDB chain | 4efe Chain A Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|