Structure of PDB 4efb Chain A Binding Site BS02 |
|
|
Ligand ID | 0OW |
InChI | InChI=1S/C15H22N4O4/c16-12-11(13(17)21)14(23-10-7-3-6-9(10)20)19-15(18-12)22-8-4-1-2-5-8/h8-10,20H,1-7H2,(H2,17,21)(H2,16,18,19)/t9-,10+/m0/s1 |
InChIKey | GOYBCUMANOWCAY-VHSXEESVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C1CCC(C1)Oc2nc(c(c(n2)O[C@@H]3CCC[C@@H]3O)C(=O)N)N | ACDLabs 12.01 | O=C(c3c(OC1CCCC1O)nc(OC2CCCC2)nc3N)N | CACTVS 3.370 | NC(=O)c1c(N)nc(OC2CCCC2)nc1O[C@@H]3CCC[C@@H]3O | OpenEye OEToolkits 1.7.6 | C1CCC(C1)Oc2nc(c(c(n2)OC3CCCC3O)C(=O)N)N | CACTVS 3.370 | NC(=O)c1c(N)nc(OC2CCCC2)nc1O[CH]3CCC[CH]3O |
|
Formula | C15 H22 N4 O4 |
Name | 4-amino-2-(cyclopentyloxy)-6-{[(1R,2S)-2-hydroxycyclopentyl]oxy}pyrimidine-5-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920817
|
PDB chain | 4efb Chain A Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|