Structure of PDB 4e90 Chain A Binding Site BS02 |
|
|
Ligand ID | 7RG |
InChI | InChI=1S/C20H25N7O2/c1-13-10-26(12-17-21-5-2-6-22-17)11-16(13)18-24-19-15(20(28)25-18)9-23-27(19)14-3-7-29-8-4-14/h2,5-6,9,13-14,16H,3-4,7-8,10-12H2,1H3,(H,24,25,28)/t13-,16-/m1/s1 |
InChIKey | IWXUVYOOUMLUTQ-CZUORRHYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | C[C@@H]1CN(C[C@H]1C2=Nc3n(ncc3C(=O)N2)C4CCOCC4)Cc5ncccn5 | CACTVS 3.370 | C[CH]1CN(C[CH]1C2=Nc3n(ncc3C(=O)N2)C4CCOCC4)Cc5ncccn5 | OpenEye OEToolkits 1.7.6 | CC1CN(CC1C2=Nc3c(cnn3C4CCOCC4)C(=O)N2)Cc5ncccn5 | OpenEye OEToolkits 1.7.6 | C[C@@H]1C[N@@](C[C@H]1C2=Nc3c(cnn3C4CCOCC4)C(=O)N2)Cc5ncccn5 | ACDLabs 12.01 | O=C2NC(=Nc1n(ncc12)C3CCOCC3)C5C(C)CN(Cc4ncccn4)C5 |
|
Formula | C20 H25 N7 O2 |
Name | 6-[(3S,4S)-4-methyl-1-(pyrimidin-2-ylmethyl)pyrrolidin-3-yl]-1-(tetrahydro-2H-pyran-4-yl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one |
ChEMBL | CHEMBL2179105 |
DrugBank | DB11953 |
ZINC | ZINC000068199983
|
PDB chain | 4e90 Chain A Residue 903
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.35: 3',5'-cyclic-GMP phosphodiesterase. |
|
|
|