Structure of PDB 4e8y Chain A Binding Site BS02 |
|
|
Ligand ID | M7B |
InChI | InChI=1S/C7H15O10P/c8-2(1-16-18(13,14)15)6-4(10)3(9)5(11)7(12)17-6/h2-12H,1H2,(H2,13,14,15)/t2-,3+,4+,5+,6-,7-/m1/s1 |
InChIKey | SDADNVAZGVDAIM-ZUHYCWGWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C([C@H]([C@@H]1[C@H]([C@@H]([C@@H]([C@@H](O1)O)O)O)O)O)OP(=O)(O)O | ACDLabs 12.01 | O=P(O)(O)OCC(O)C1OC(O)C(O)C(O)C1O | OpenEye OEToolkits 1.7.6 | C(C(C1C(C(C(C(O1)O)O)O)O)O)OP(=O)(O)O | CACTVS 3.370 | O[CH](CO[P](O)(O)=O)[CH]1O[CH](O)[CH](O)[CH](O)[CH]1O | CACTVS 3.370 | O[C@H](CO[P](O)(O)=O)[C@H]1O[C@@H](O)[C@@H](O)[C@@H](O)[C@@H]1O |
|
Formula | C7 H15 O10 P |
Name | 7-O-phosphono-D-glycero-beta-D-manno-heptopyranose; 7-O-phosphono-D-glycero-beta-D-manno-heptose; 7-O-phosphono-D-glycero-D-manno-heptose; 7-O-phosphono-D-glycero-manno-heptose |
ChEMBL | |
DrugBank | |
ZINC | ZINC000004097441
|
PDB chain | 4e8y Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|