Structure of PDB 4e5j Chain A Binding Site BS02 |
|
|
Ligand ID | 581 |
InChI | InChI=1S/C13H11N3O5/c1-6(17)14-8-4-2-3-7(5-8)11-15-9(13(20)21)10(18)12(19)16-11/h2-5,18H,1H3,(H,14,17)(H,20,21)(H,15,16,19) |
InChIKey | YVWVRDSWELUHOD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(=O)Nc1cccc(c1)C2=NC(=C(C(=O)N2)O)C(=O)O | ACDLabs 12.01 | O=C2C(O)=C(N=C(c1cccc(NC(=O)C)c1)N2)C(=O)O | CACTVS 3.370 | CC(=O)Nc1cccc(c1)C2=NC(=C(O)C(=O)N2)C(O)=O |
|
Formula | C13 H11 N3 O5 |
Name | 2-[3-(acetylamino)phenyl]-5-hydroxy-6-oxo-1,6-dihydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL2040562 |
DrugBank | |
ZINC | ZINC000084704406
|
PDB chain | 4e5j Chain A Residue 304
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|