Structure of PDB 4dz9 Chain A Binding Site BS02 |
|
|
Ligand ID | ID4 |
InChI | InChI=1S/C15H16F4N4O2S/c16-10-12(18)15(26(20,24)25)13(19)11(17)14(10)23-7-9(21-22-23)6-8-4-2-1-3-5-8/h7-8H,1-6H2,(H2,20,24,25) |
InChIKey | AKKBBWYMCAYCPJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S(=O)(c1c(F)c(F)c(c(F)c1F)n2nnc(c2)CC3CCCCC3)N | CACTVS 3.370 | N[S](=O)(=O)c1c(F)c(F)c(n2cc(CC3CCCCC3)nn2)c(F)c1F | OpenEye OEToolkits 1.7.6 | c1c(nnn1c2c(c(c(c(c2F)F)S(=O)(=O)N)F)F)CC3CCCCC3 |
|
Formula | C15 H16 F4 N4 O2 S |
Name | 4-[4-(cyclohexylmethyl)-1H-1,2,3-triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920655
|
PDB chain | 4dz9 Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|