Structure of PDB 4dk8 Chain A Binding Site BS02 |
|
|
Ligand ID | 0KT |
InChI | InChI=1S/C22H23F3N2O4S/c1-26(32(29,30)19-7-4-3-5-8-19)18-12-10-17(11-13-18)21(28,22(23,24)25)20-9-6-14-27(20)15-16-31-2/h3-14,28H,15-16H2,1-2H3/t21-/m0/s1 |
InChIKey | YNUCWQDMZHYFEC-NRFANRHFSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CN(c1ccc(cc1)C(c2cccn2CCOC)(C(F)(F)F)O)S(=O)(=O)c3ccccc3 | CACTVS 3.370 | COCCn1cccc1[C@@](O)(c2ccc(cc2)N(C)[S](=O)(=O)c3ccccc3)C(F)(F)F | OpenEye OEToolkits 1.7.6 | CN(c1ccc(cc1)[C@](c2cccn2CCOC)(C(F)(F)F)O)S(=O)(=O)c3ccccc3 | ACDLabs 12.01 | O=S(=O)(c1ccccc1)N(c2ccc(cc2)C(O)(c3cccn3CCOC)C(F)(F)F)C | CACTVS 3.370 | COCCn1cccc1[C](O)(c2ccc(cc2)N(C)[S](=O)(=O)c3ccccc3)C(F)(F)F |
|
Formula | C22 H23 F3 N2 O4 S |
Name | N-methyl-N-(4-{(1S)-2,2,2-trifluoro-1-hydroxy-1-[1-(2-methoxyethyl)-1H-pyrrol-2-yl]ethyl}phenyl)benzenesulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000084605093
|
PDB chain | 4dk8 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|