Structure of PDB 4di8 Chain A Binding Site BS02 |
|
|
Ligand ID | 0GY |
InChI | InChI=1S/C7H6O7/c8-4(7(13)14)1-3(6(11)12)2-5(9)10/h1-2,8H,(H,9,10)(H,11,12)(H,13,14)/b3-2+,4-1- |
InChIKey | QWLUKZXOQAQUFQ-NAOWAUKJSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)C(\O)=C\C(\C(=O)O)=C/C(=O)O | OpenEye OEToolkits 1.7.6 | C(=C(C=C(C(=O)O)O)C(=O)O)C(=O)O | CACTVS 3.370 | OC(=O)C=C(C=C(O)C(O)=O)C(O)=O | CACTVS 3.370 | OC(=O)\C=C(/C=C(O)/C(O)=O)C(O)=O | OpenEye OEToolkits 1.7.6 | C(=C(\C=C(\C(=O)O)/O)/C(=O)O)\C(=O)O |
|
Formula | C7 H6 O7 |
Name | (1E,3Z)-4-hydroxybuta-1,3-diene-1,2,4-tricarboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000100085022
|
PDB chain | 4di8 Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
A248 |
Catalytic site (residue number reindexed from 1) |
A247 |
Enzyme Commision number |
3.1.1.57: 2-pyrone-4,6-dicarboxylate lactonase. |
|
|
|