Structure of PDB 4ct1 Chain A Binding Site BS02 |
|
|
Ligand ID | 31S |
InChI | InChI=1S/C23H19ClO2/c24-22-14-7-17(8-15-22)6-9-21(16-23(25)26)20-12-10-19(11-13-20)18-4-2-1-3-5-18/h1-5,7-8,10-16H,6,9H2,(H,25,26)/b21-16- |
InChIKey | KXEKGLNMBLODQT-PGMHBOJBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)C=C(CCc1ccc(Cl)cc1)c2ccc(cc2)c3ccccc3 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)c2ccc(cc2)C(=CC(=O)O)CCc3ccc(cc3)Cl | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)c2ccc(cc2)/C(=C\C(=O)O)/CCc3ccc(cc3)Cl | CACTVS 3.385 | OC(=O)\C=C(\CCc1ccc(Cl)cc1)c2ccc(cc2)c3ccccc3 | ACDLabs 12.01 | Clc1ccc(cc1)CCC(\c3ccc(c2ccccc2)cc3)=C\C(=O)O |
|
Formula | C23 H19 Cl O2 |
Name | (2Z)-3-(biphenyl-4-yl)-5-(4-chlorophenyl)pent-2-enoic acid; PS315 |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208375
|
PDB chain | 4ct1 Chain A Residue 600
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|