Structure of PDB 4clo Chain A Binding Site BS02 |
|
|
Ligand ID | XP0 |
InChI | InChI=1S/C18H17N5/c19-18-21-16-15(17(22-18)23-10-4-5-11-23)14(12-20-16)9-8-13-6-2-1-3-7-13/h1-3,6-7,12H,4-5,10-11H2,(H3,19,20,21,22) |
InChIKey | PFDYIZWUJSPGHR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | n2c(nc(c3c(C#Cc1ccccc1)cnc23)N4CCCC4)N | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)C#Cc2c[nH]c3c2c(nc(n3)N)N4CCCC4 | CACTVS 3.385 | Nc1nc2[nH]cc(C#Cc3ccccc3)c2c(n1)N4CCCC4 |
|
Formula | C18 H17 N5 |
Name | 5-(phenylethynyl)-4-(pyrrolidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
ChEMBL | CHEMBL3318495 |
DrugBank | |
ZINC | ZINC000222800142
|
PDB chain | 4clo Chain A Residue 1270
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|