Structure of PDB 4ck8 Chain A Binding Site BS02 |
|
|
Ligand ID | LFD |
InChI | InChI=1S/C28H25Cl4N5O2/c29-19-1-7-23(25(31)15-19)27(17-35-10-9-33-18-35)39-28(38)34-20-2-4-21(5-3-20)36-11-13-37(14-12-36)22-6-8-24(30)26(32)16-22/h1-10,15-16,18,27H,11-14,17H2,(H,34,38)/t27-/m0/s1 |
InChIKey | RKYWJGOKHMLHHS-MHZLTWQESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(ccc1NC(=O)OC(Cn2ccnc2)c3ccc(cc3Cl)Cl)N4CCN(CC4)c5ccc(c(c5)Cl)Cl | CACTVS 3.385 | Clc1ccc([C@H](Cn2ccnc2)OC(=O)Nc3ccc(cc3)N4CCN(CC4)c5ccc(Cl)c(Cl)c5)c(Cl)c1 | ACDLabs 12.01 | Clc1ccc(cc1Cl)N5CCN(c2ccc(cc2)NC(=O)OC(c3ccc(Cl)cc3Cl)Cn4ccnc4)CC5 | OpenEye OEToolkits 1.7.6 | c1cc(ccc1NC(=O)O[C@@H](Cn2ccnc2)c3ccc(cc3Cl)Cl)N4CCN(CC4)c5ccc(c(c5)Cl)Cl | CACTVS 3.385 | Clc1ccc([CH](Cn2ccnc2)OC(=O)Nc3ccc(cc3)N4CCN(CC4)c5ccc(Cl)c(Cl)c5)c(Cl)c1 |
|
Formula | C28 H25 Cl4 N5 O2 |
Name | (1R)-1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethyl {4-[4-(3,4-dichlorophenyl)piperazin-1-yl]phenyl}carbamate |
ChEMBL | CHEMBL3318325 |
DrugBank | |
ZINC | ZINC000098209109
|
PDB chain | 4ck8 Chain A Residue 1490
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
S296 |
Catalytic site (residue number reindexed from 1) |
S267 |
Enzyme Commision number |
1.14.14.154: sterol 14alpha-demethylase. |
|
|
|