Structure of PDB 4c4r Chain A Binding Site BS02 |
|
|
Ligand ID | YO5 |
InChI | InChI=1S/C7H15O8P/c8-1-3-5(9)7(11)6(10)4(15-3)2-16(12,13)14/h3-11H,1-2H2,(H2,12,13,14)/t3-,4+,5-,6+,7+/m1/s1 |
InChIKey | XRMRHVWWWWFMKR-UOYQFSTFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC[CH]1O[CH](C[P](O)(O)=O)[CH](O)[CH](O)[CH]1O | OpenEye OEToolkits 1.9.2 | C(C1C(C(C(C(O1)CP(=O)(O)O)O)O)O)O | OpenEye OEToolkits 1.9.2 | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)CP(=O)(O)O)O)O)O)O | ACDLabs 12.01 | O=P(O)(O)CC1OC(C(O)C(O)C1O)CO | CACTVS 3.385 | OC[C@H]1O[C@@H](C[P](O)(O)=O)[C@H](O)[C@@H](O)[C@@H]1O |
|
Formula | C7 H15 O8 P |
Name | (1R)-1,5-anhydro-1-(phosphonomethyl)-D-glucitol; Beta-1 phosphonomethylene-D-glucopyranose |
ChEMBL | |
DrugBank | |
ZINC | ZINC000080898227
|
PDB chain | 4c4r Chain A Residue 1220
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|