Structure of PDB 4bt4 Chain A Binding Site BS02 |
|
|
Ligand ID | QFH |
InChI | InChI=1S/C5H10O4/c1-3(6)5(2,9)4(7)8/h3,6,9H,1-2H3,(H,7,8)/t3-,5-/m0/s1 |
InChIKey | AOWPAWLEXIYETE-UCORVYFPSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | C[C@@H]([C@@](C)(C(=O)O)O)O | CACTVS 3.385 | C[C@H](O)[C@](C)(O)C(O)=O | OpenEye OEToolkits 1.9.2 | CC(C(C)(C(=O)O)O)O | ACDLabs 12.01 | O=C(O)C(O)(C)C(O)C | CACTVS 3.385 | C[CH](O)[C](C)(O)C(O)=O |
|
Formula | C5 H10 O4 |
Name | (2S,3S)-2,3-dihydroxy-2-methylbutanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000001731109
|
PDB chain | 4bt4 Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.1.1.5: acetolactate decarboxylase. |
|
|
|