Structure of PDB 4axa Chain A Binding Site BS02 |
|
|
Ligand ID | RKD |
InChI | InChI=1S/C17H16ClN3O/c18-16-7-5-15(6-8-16)17(22,11-19)14-3-1-12(2-4-14)13-9-20-21-10-13/h1-10,22H,11,19H2,(H,20,21)/p+1/t17-/m0/s1 |
InChIKey | IIRWNGPLJQXWFJ-KRWDZBQOSA-O |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | [NH3+]C[C](O)(c1ccc(Cl)cc1)c2ccc(cc2)c3c[nH]nc3 | OpenEye OEToolkits 1.7.6 | c1cc(ccc1c2c[nH]nc2)C(C[NH3+])(c3ccc(cc3)Cl)O | OpenEye OEToolkits 1.7.6 | c1cc(ccc1c2c[nH]nc2)[C@@](C[NH3+])(c3ccc(cc3)Cl)O | ACDLabs 12.01 | Clc1ccc(cc1)C(O)(c3ccc(c2cnnc2)cc3)C[NH3+] | CACTVS 3.370 | [NH3+]C[C@@](O)(c1ccc(Cl)cc1)c2ccc(cc2)c3c[nH]nc3 |
|
Formula | C17 H17 Cl N3 O |
Name | (2S)-2-(4-chlorophenyl)-2-hydroxy-2-[4-(1H-pyrazol-4-yl)phenyl]ethanaminium; (1S)-2-AMINO-1-(4-CHLOROPHENYL)-1-(4-(1H-PYRAZOL-4-YL)PHENYL)ETHAN-1-OL |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4axa Chain A Residue 1351
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|