Structure of PDB 4aw0 Chain A Binding Site BS02 |
|
|
Ligand ID | MJF |
InChI | InChI=1S/C18H15ClO5/c19-13-8-6-12(7-9-13)15(20)10-14(11-4-2-1-3-5-11)16(17(21)22)18(23)24/h1-9,14,16H,10H2,(H,21,22)(H,23,24)/t14-/m0/s1 |
InChIKey | XOOQYQRTMFAOAP-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)C([C@@H](CC(=O)c1ccc(Cl)cc1)c2ccccc2)C(O)=O | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)C(CC(=O)c2ccc(cc2)Cl)C(C(=O)O)C(=O)O | CACTVS 3.385 | OC(=O)C([CH](CC(=O)c1ccc(Cl)cc1)c2ccccc2)C(O)=O | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)[C@H](CC(=O)c2ccc(cc2)Cl)C(C(=O)O)C(=O)O | ACDLabs 12.01 | O=C(c1ccc(Cl)cc1)CC(c2ccccc2)C(C(=O)O)C(=O)O |
|
Formula | C18 H15 Cl O5 |
Name | [(1R)-3-(4-chlorophenyl)-3-oxo-1-phenylpropyl]propanedioic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095573294
|
PDB chain | 4aw0 Chain A Residue 600
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|