Structure of PDB 3zg2 Chain A Binding Site BS02 |
|
|
Ligand ID | UDO |
InChI | InChI=1S/C24H21ClF3N3O/c25-20-7-3-17(4-8-20)22(18-2-1-11-29-16-18)23(32)31-14-12-30(13-15-31)21-9-5-19(6-10-21)24(26,27)28/h1-11,16,22H,12-15H2/t22-/m0/s1 |
InChIKey | OJFZYAQGMWSUID-QFIPXVFZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | FC(F)(F)c1ccc(cc1)N2CCN(CC2)C(=O)[CH](c3ccc(Cl)cc3)c4cccnc4 | OpenEye OEToolkits 1.9.2 | c1cc(cnc1)[C@H](c2ccc(cc2)Cl)C(=O)N3CCN(CC3)c4ccc(cc4)C(F)(F)F | CACTVS 3.385 | FC(F)(F)c1ccc(cc1)N2CCN(CC2)C(=O)[C@@H](c3ccc(Cl)cc3)c4cccnc4 | ACDLabs 12.01 | O=C(N2CCN(c1ccc(cc1)C(F)(F)F)CC2)C(c3ccc(Cl)cc3)c4cccnc4 | OpenEye OEToolkits 1.9.2 | c1cc(cnc1)C(c2ccc(cc2)Cl)C(=O)N3CCN(CC3)c4ccc(cc4)C(F)(F)F |
|
Formula | C24 H21 Cl F3 N3 O |
Name | (S)-2-(4-chlorophenyl)-2-pyridin-3-yl-1-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
ChEMBL | CHEMBL3104526 |
DrugBank | |
ZINC | ZINC000095920780
|
PDB chain | 3zg2 Chain A Residue 1490
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
S296 |
Catalytic site (residue number reindexed from 1) |
S267 |
Enzyme Commision number |
1.14.14.154: sterol 14alpha-demethylase. |
|
|
|