Structure of PDB 3zei Chain A Binding Site BS02 |
|
|
Ligand ID | AWH |
InChI | InChI=1S/C20H16N2O6S/c1-22-18(25)16(10-12-5-2-3-8-15(12)28-11-17(23)24)29-20(22)21-14-7-4-6-13(9-14)19(26)27/h2-10H,11H2,1H3,(H,23,24)(H,26,27)/b16-10-,21-20- |
InChIKey | ZRWLYRDALGQUID-PTWQKYQPSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CN\1C(=O)/C(=C/c2ccccc2OCC(=O)O)/S/C1=N\c3cccc(c3)C(=O)O | CACTVS 3.385 | CN1C(=O)C(SC1=Nc2cccc(c2)C(O)=O)=Cc3ccccc3OCC(O)=O | OpenEye OEToolkits 1.9.2 | CN1C(=O)C(=Cc2ccccc2OCC(=O)O)SC1=Nc3cccc(c3)C(=O)O | CACTVS 3.385 | CN1C(=O)C(/SC1=Nc2cccc(c2)C(O)=O)=C/c3ccccc3OCC(O)=O | ACDLabs 12.01 | O=C(O)COc1ccccc1\C=C3/S/C(=N\c2cccc(C(=O)O)c2)N(C3=O)C |
|
Formula | C20 H16 N2 O6 S |
Name | 3-[(Z)-[(5Z)-5-[[2-(2-hydroxy-2-oxoethyloxy)phenyl]methylidene]-3-methyl-4-oxidanylidene-1,3-thiazolidin-2-ylidene]amino]benzoic acid; 3-((Z)-((Z)-5-(2(carboxymethoxy)benzylidene)-3-methyl-4-oxothiazolidin-2-ylidene)amino)benzoic acid |
ChEMBL | CHEMBL2418558 |
DrugBank | |
ZINC |
|
PDB chain | 3zei Chain A Residue 1302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
K44 S266 P293 |
Catalytic site (residue number reindexed from 1) |
K44 S266 P293 |
Enzyme Commision number |
2.5.1.47: cysteine synthase. |
|
|
|