Structure of PDB 3zcw Chain A Binding Site BS02 |
|
|
Ligand ID | 4A2 |
InChI | InChI=1S/C23H17F4N3O3/c1-33-20-9-7-15(11-17(20)24)28-22-29-18-10-13(21(31)32)6-8-19(18)30(22)12-14-4-2-3-5-16(14)23(25,26)27/h2-11H,12H2,1H3,(H,28,29)(H,31,32) |
InChIKey | KSDBWRGNYBMBEZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | FC(F)(F)c1ccccc1CN4c2ccc(cc2N\C4=N/c3ccc(OC)c(F)c3)C(=O)O | OpenEye OEToolkits 1.9.2 | COc1ccc(cc1F)/N=C/2\Nc3cc(ccc3N2Cc4ccccc4C(F)(F)F)C(=O)O | CACTVS 3.385 | COc1ccc(cc1F)N=C2Nc3cc(ccc3N2Cc4ccccc4C(F)(F)F)C(O)=O | OpenEye OEToolkits 1.9.2 | COc1ccc(cc1F)N=C2Nc3cc(ccc3N2Cc4ccccc4C(F)(F)F)C(=O)O |
|
Formula | C23 H17 F4 N3 O3 |
Name | (2E)-2-(3-fluoranyl-4-methoxy-phenyl)imino-1-[[2-(trifluoromethyl)phenyl]methyl]-3H-benzimidazole-5-carboxylic acid |
ChEMBL | CHEMBL558476 |
DrugBank | |
ZINC |
|
PDB chain | 3zcw Chain A Residue 1366
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|