Structure of PDB 3wsb Chain A Binding Site BS02 |
|
|
Ligand ID | RWZ |
InChI | InChI=1S/C22H38N2/c1-16(2)5-4-6-17(3)7-8-23-9-10-24-22-20-12-18-11-19(14-20)15-21(22)13-18/h5,7,18-24H,4,6,8-15H2,1-3H3/b17-7-/t18-,19+,20-,21+,22- |
InChIKey | JFIBVDBTCDTBRH-MDXVBTBDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | CC(=CCC/C(=C\CNCCNC1C2CC3CC(C2)CC1C3)/C)C | CACTVS 3.370 | CC(C)=CCCC(C)=CCNCCNC1C2CC3CC(C2)CC1C3 | CACTVS 3.370 | CC(C)=CCCC(\C)=C/CNCCNC1C2CC3CC(C2)CC1C3 | OpenEye OEToolkits 1.7.2 | CC(=CCCC(=CCNCCNC1C2CC3CC(C2)CC1C3)C)C | ACDLabs 12.01 | C(=C\CCC(=C/CNCCNC3C1CC2CC3CC(C1)C2)\C)(\C)C |
|
Formula | C22 H38 N2 |
Name | N-[(2Z)-3,7-dimethylocta-2,6-dien-1-yl]-N'-[(1R,3S,5R,7R)-tricyclo[3.3.1.1~3,7~]dec-2-yl]ethane-1,2-diamine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 3wsb Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|