Structure of PDB 3wf7 Chain A Binding Site BS02 |
|
|
Ligand ID | FS9 |
InChI | InChI=1S/C18H17F3N6O/c19-18(20,21)12-2-1-3-13(8-12)26-17(28)11-4-6-27(7-5-11)16-14-15(23-9-22-14)24-10-25-16/h1-3,8-11H,4-7H2,(H,26,28)(H,22,23,24,25) |
InChIKey | RSRHDIYCQIWTON-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | FC(F)(F)c1cccc(NC(=O)C2CCN(CC2)c3ncnc4[nH]cnc34)c1 | ACDLabs 12.01 | FC(F)(F)c1cc(ccc1)NC(=O)C4CCN(c3ncnc2c3ncn2)CC4 | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)NC(=O)C2CCN(CC2)c3c4c([nH]cn4)ncn3)C(F)(F)F |
|
Formula | C18 H17 F3 N6 O |
Name | 1-(9H-purin-6-yl)-N-[3-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000009059591
|
PDB chain | 3wf7 Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|