Structure of PDB 3w1q Chain A Binding Site BS02 |
|
|
Ligand ID | YRO |
InChI | InChI=1S/C11H16N2O4/c1-11(2,3)5-4-6-7(9(15)16)12-10(17)13-8(6)14/h4-5H2,1-3H3,(H,15,16)(H2,12,13,14,17) |
InChIKey | HROWFJPIAGSCKL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1NC(C(=O)O)=C(C(=O)N1)CCC(C)(C)C | CACTVS 3.370 | CC(C)(C)CCC1=C(NC(=O)NC1=O)C(O)=O | OpenEye OEToolkits 1.7.6 | CC(C)(C)CCC1=C(NC(=O)NC1=O)C(=O)O |
|
Formula | C11 H16 N2 O4 |
Name | 5-(3,3-dimethylbutyl)-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920974
|
PDB chain | 3w1q Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|