Structure of PDB 3w1m Chain A Binding Site BS02 |
|
|
Ligand ID | RRO |
InChI | InChI=1S/C5H3BrN2O4/c6-1-2(4(10)11)7-5(12)8-3(1)9/h(H,10,11)(H2,7,8,9,12) |
InChIKey | YQYHIPBLZSIHDI-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1NC(C(=O)O)=C(Br)C(=O)N1 | OpenEye OEToolkits 1.7.6 | C1(=C(NC(=O)NC1=O)C(=O)O)Br | CACTVS 3.370 | OC(=O)C1=C(Br)C(=O)NC(=O)N1 |
|
Formula | C5 H3 Br N2 O4 |
Name | 5-bromo-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid; 5-bromoorotic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000001666478
|
PDB chain | 3w1m Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|