Structure of PDB 3w0g Chain A Binding Site BS02 |
|
|
Ligand ID | W07 |
InChI | InChI=1S/C24H34O5/c1-23(2,3)22(27)16-29-21-12-8-18(9-13-21)24(4,5)17-6-10-20(11-7-17)28-15-19(26)14-25/h6-13,19,22,25-27H,14-16H2,1-5H3/t19-,22-/m0/s1 |
InChIKey | NSXHQTLHHLJUGK-UGKGYDQZSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O(c1ccc(cc1)C(c2ccc(OCC(O)C(C)(C)C)cc2)(C)C)CC(O)CO | OpenEye OEToolkits 1.7.6 | CC(C)(C)C(COc1ccc(cc1)C(C)(C)c2ccc(cc2)OCC(CO)O)O | CACTVS 3.370 | CC(C)(C)[CH](O)COc1ccc(cc1)C(C)(C)c2ccc(OC[CH](O)CO)cc2 | CACTVS 3.370 | CC(C)(C)[C@@H](O)COc1ccc(cc1)C(C)(C)c2ccc(OC[C@@H](O)CO)cc2 | OpenEye OEToolkits 1.7.6 | CC(C)(C)[C@H](COc1ccc(cc1)C(C)(C)c2ccc(cc2)OC[C@H](CO)O)O |
|
Formula | C24 H34 O5 |
Name | (2S)-3-{4-[2-(4-{[(2R)-2-hydroxy-3,3-dimethylbutyl]oxy}phenyl)propan-2-yl]phenoxy}propane-1,2-diol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920962
|
PDB chain | 3w0g Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|