Structure of PDB 3vf6 Chain A Binding Site BS02 |
|
|
Ligand ID | 0H6 |
InChI | InChI=1S/C18H19F3N4O3/c19-18(20,21)14-9-25(10-23-14)13(7-11-3-1-2-4-11)16(26)24-15-6-5-12(8-22-15)17(27)28/h5-6,8-11,13H,1-4,7H2,(H,27,28)(H,22,24,26)/t13-/m0/s1 |
InChIKey | GKMLFBRLRVQVJO-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)c1ccc(nc1)NC(=O)C(n2cc(nc2)C(F)(F)F)CC3CCCC3 | OpenEye OEToolkits 1.7.6 | c1cc(ncc1C(=O)O)NC(=O)[C@H](CC2CCCC2)n3cc(nc3)C(F)(F)F | OpenEye OEToolkits 1.7.6 | c1cc(ncc1C(=O)O)NC(=O)C(CC2CCCC2)n3cc(nc3)C(F)(F)F | CACTVS 3.370 | OC(=O)c1ccc(NC(=O)[C@H](CC2CCCC2)n3cnc(c3)C(F)(F)F)nc1 | CACTVS 3.370 | OC(=O)c1ccc(NC(=O)[CH](CC2CCCC2)n3cnc(c3)C(F)(F)F)nc1 |
|
Formula | C18 H19 F3 N4 O3 |
Name | 6-({(2S)-3-cyclopentyl-2-[4-(trifluoromethyl)-1H-imidazol-1-yl]propanoyl}amino)pyridine-3-carboxylic acid |
ChEMBL | CHEMBL2165620 |
DrugBank | DB11765 |
ZINC | ZINC000068250431
|
PDB chain | 3vf6 Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|